C11H10IN — CID 118507154
(2Z,4Z)-5-iodo-2-phenylpenta-2,4-dien-1-imine (PubChem CID 118507154) has the molecular formula C11H10IN and a molecular weight of 283.11 g/mol. Its IUPAC name is (2Z,4Z)-5-iodo-2-phenylpenta-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-5-iodo-2-phenylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 118507154 |
| Molecular Formula | C11H10IN |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | (2Z,4Z)-5-iodo-2-phenylpenta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C=C/I)c1ccccc1 |
| InChI | InChI=1S/C11H10IN/c12-8-4-7-11(9-13)10-5-2-1-3-6-10/h1-9,13H/b8-4-,11-7+,13-9+ |
| InChIKey | PNJMMSFNROOOET-PYMKHPLCSA-N |
| XLogP | 3.67 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|