About 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene
1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene (PubChem CID 154510274) has the molecular formula C20H18O2S
and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene.
Molecular Properties
| Compound Name | 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene |
| PubChem CID | 154510274 |
| Molecular Formula | C20H18O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene |
| SMILES | C=CC(=CS(=O)(=O)C=C(C=C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O2S/c1-3-17(19-11-7-5-8-12-19)15-23(21,22)16-18(4-2)20-13-9-6-10-14-20/h3-16H,1-2H2 |
| InChIKey | JYEUJOCIGDITHK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene?
The IUPAC name of 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene (CID 154510274) is 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene.
What is the SMILES notation for 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene?
The canonical SMILES for 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene is C=CC(=CS(=O)(=O)C=C(C=C)c1ccccc1)c1ccccc1.
What is the InChIKey of 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene?
The InChIKey is JYEUJOCIGDITHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O2S/c1-3-17(19-11-7-5-8-12-19)15-23(21,22)16-18(4-2)20-13-9-6-10-14-20/h3-16H,1-2H2.
What are the key properties of 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene?
1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene has a molecular weight of 322.43 g/mol, XLogP of 4.86, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-phenylbuta-1,3-dienylsulfonyl)buta-1,3-dien-2-ylbenzene is sourced from PubChem (CID 154510274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).