C10H10N2 — CID 144911563
(Z)-N'-methylidene-2-phenylprop-2-ene-1,3-diimine (PubChem CID 144911563) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (Z)-N'-methylidene-2-phenylprop-2-ene-1,3-diimine.
| Compound Name | (Z)-N'-methylidene-2-phenylprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 144911563 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | (Z)-N'-methylidene-2-phenylprop-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C(=C\N=C)c1ccccc1 |
| InChI | InChI=1S/C10H10N2/c1-12-8-10(7-11)9-5-3-2-4-6-9/h2-8,11H,1H2/b10-8+,11-7+ |
| InChIKey | QFHYMWMRBGMWND-VTTRTIMMSA-N |
| XLogP | 2.38 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|