C13H13NS — CID 170269602
(3Z)-5-methanimidoyl-3-phenylhexa-1,3,5-triene-2-thiol (PubChem CID 170269602) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is (3Z)-5-methanimidoyl-3-phenylhexa-1,3,5-triene-2-thiol.
| Compound Name | (3Z)-5-methanimidoyl-3-phenylhexa-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 170269602 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (3Z)-5-methanimidoyl-3-phenylhexa-1,3,5-triene-2-thiol |
| SMILES | [H]/N=C/C(=C)/C=C(\C(=C)S)c1ccccc1 |
| InChI | InChI=1S/C13H13NS/c1-10(9-14)8-13(11(2)15)12-6-4-3-5-7-12/h3-9,14-15H,1-2H2/b13-8+,14-9+ |
| InChIKey | PLQPXJDHVQUJIT-UQNWOCKMSA-N |
| XLogP | 3.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|