C18H20N2O — CID 143625554
ethane;(Z)-4-imino-2,3-diphenylbut-2-enamide (PubChem CID 143625554) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is ethane;(Z)-4-imino-2,3-diphenylbut-2-enamide.
| Compound Name | ethane;(Z)-4-imino-2,3-diphenylbut-2-enamide |
|---|---|
| PubChem CID | 143625554 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | ethane;(Z)-4-imino-2,3-diphenylbut-2-enamide |
| SMILES | CC.[H]/N=C/C(=C(\C(N)=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O.C2H6/c17-11-14(12-7-3-1-4-8-12)15(16(18)19)13-9-5-2-6-10-13;1-2/h1-11,17H,(H2,18,19);1-2H3/b15-14+,17-11+; |
| InChIKey | FMEXDVYHWNFCEW-DZNCTZNGSA-N |
| XLogP | 3.76 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|