About ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide
ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide (PubChem CID 143625473) has the molecular formula C14H14N2OS2
and a molecular weight of 290.41 g/mol. Its IUPAC name is ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide.
Molecular Properties
| Compound Name | ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide |
| PubChem CID | 143625473 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide |
| SMILES | C=C.[H]/N=C/C(=C(\C(N)=O)c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C12H10N2OS2.C2H4/c13-5-10(8-1-3-16-6-8)11(12(14)15)9-2-4-17-7-9;1-2/h1-7,13H,(H2,14,15);1-2H2/b11-10+,13-5+; |
| InChIKey | PXNZGNCDDIEJKA-FAQOJWHUSA-N |
| XLogP | 3.66 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide?
The IUPAC name of ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide (CID 143625473) is ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide.
What is the SMILES notation for ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide?
The canonical SMILES for ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide is C=C.[H]/N=C/C(=C(\C(N)=O)c1ccsc1)c1ccsc1.
What is the InChIKey of ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide?
The InChIKey is PXNZGNCDDIEJKA-FAQOJWHUSA-N. The full InChI is InChI=1S/C12H10N2OS2.C2H4/c13-5-10(8-1-3-16-6-8)11(12(14)15)9-2-4-17-7-9;1-2/h1-7,13H,(H2,14,15);1-2H2/b11-10+,13-5+;.
What are the key properties of ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide?
ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide has a molecular weight of 290.41 g/mol, XLogP of 3.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;(Z)-4-imino-2,3-di(thiophen-3-yl)but-2-enamide is sourced from PubChem (CID 143625473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).