C8H12N2O2S — CID 122460781
acetic acid;2-thiophen-3-ylethanimidamide (PubChem CID 122460781) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is acetic acid;2-thiophen-3-ylethanimidamide.
| Compound Name | acetic acid;2-thiophen-3-ylethanimidamide |
|---|---|
| PubChem CID | 122460781 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | acetic acid;2-thiophen-3-ylethanimidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)Cc1ccsc1 |
| InChI | InChI=1S/C6H8N2S.C2H4O2/c7-6(8)3-5-1-2-9-4-5;1-2(3)4/h1-2,4H,3H2,(H3,7,8);1H3,(H,3,4) |
| InChIKey | JRQIXMMCPUUWIO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|