C7H10N2S2 — CID 65211727
2-thiophen-3-ylethyl carbamimidothioate (PubChem CID 65211727) has the molecular formula C7H10N2S2 and a molecular weight of 186.31 g/mol. Its IUPAC name is 2-thiophen-3-ylethyl carbamimidothioate.
| Compound Name | 2-thiophen-3-ylethyl carbamimidothioate |
|---|---|
| PubChem CID | 65211727 |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.31 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-thiophen-3-ylethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccsc1 |
| InChI | InChI=1S/C7H10N2S2/c8-7(9)11-4-2-6-1-3-10-5-6/h1,3,5H,2,4H2,(H3,8,9) |
| InChIKey | INGSLIKNEILCLH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|