C13H16N6S2 — CID 170226142
2-[4-(5-carbamimidoylsulfanylpyrazol-1-yl)phenyl]ethyl carbamimidothioate (PubChem CID 170226142) has the molecular formula C13H16N6S2 and a molecular weight of 320.45 g/mol. Its IUPAC name is 2-[4-(5-carbamimidoylsulfanylpyrazol-1-yl)phenyl]ethyl carbamimidothioate.
| Compound Name | 2-[4-(5-carbamimidoylsulfanylpyrazol-1-yl)phenyl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 170226142 |
| Molecular Formula | C13H16N6S2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[4-(5-carbamimidoylsulfanylpyrazol-1-yl)phenyl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccc(-n2nccc2S/C(N)=N/[H])cc1 |
| InChI | InChI=1S/C13H16N6S2/c14-12(15)20-8-6-9-1-3-10(4-2-9)19-11(5-7-18-19)21-13(16)17/h1-5,7H,6,8H2,(H3,14,15)(H3,16,17) |
| InChIKey | ULYQDDLVGIKOBF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|