C14H22N4S2 — CID 169053113
2-[4-(2-carbamimidoylsulfanylethyl)phenyl]ethyl N,N-dimethylcarbamimidothioate (PubChem CID 169053113) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 2-[4-(2-carbamimidoylsulfanylethyl)phenyl]ethyl N,N-dimethylcarbamimidothioate.
| Compound Name | 2-[4-(2-carbamimidoylsulfanylethyl)phenyl]ethyl N,N-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 169053113 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[4-(2-carbamimidoylsulfanylethyl)phenyl]ethyl N,N-dimethylcarbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccc(CCS/C(=N/[H])N(C)C)cc1 |
| InChI | InChI=1S/C14H22N4S2/c1-18(2)14(17)20-10-8-12-5-3-11(4-6-12)7-9-19-13(15)16/h3-6,17H,7-10H2,1-2H3,(H3,15,16)/b17-14+ |
| InChIKey | QUMAHNIYZBEXGZ-SAPNQHFASA-N |
| XLogP | 2.63 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|