C12H17N3OS — CID 36521631
[2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl] carbamimidothioate (PubChem CID 36521631) has the molecular formula C12H17N3OS and a molecular weight of 251.36 g/mol. Its IUPAC name is [2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 36521631 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | [2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)N(C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C12H17N3OS/c1-9-3-5-10(6-4-9)7-15(2)11(16)8-17-12(13)14/h3-6H,7-8H2,1-2H3,(H3,13,14) |
| InChIKey | RYZIUTRKBOJNGD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|