C15H23N3O2S3 — CID 170225493
[(2R)-2-[4-(2-carbamimidoylsulfanylethyl)phenyl]-3-methylsulfonylpropyl] ethanimidothioate (PubChem CID 170225493) has the molecular formula C15H23N3O2S3 and a molecular weight of 373.57 g/mol. Its IUPAC name is [(2R)-2-[4-(2-carbamimidoylsulfanylethyl)phenyl]-3-methylsulfonylpropyl] ethanimidothioate.
| Compound Name | [(2R)-2-[4-(2-carbamimidoylsulfanylethyl)phenyl]-3-methylsulfonylpropyl] ethanimidothioate |
|---|---|
| PubChem CID | 170225493 |
| Molecular Formula | C15H23N3O2S3 |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [(2R)-2-[4-(2-carbamimidoylsulfanylethyl)phenyl]-3-methylsulfonylpropyl] ethanimidothioate |
| SMILES | [H]/N=C(\C)SC[C@H](CS(C)(=O)=O)c1ccc(CCS/C(N)=N/[H])cc1 |
| InChI | InChI=1S/C15H23N3O2S3/c1-11(16)22-9-14(10-23(2,19)20)13-5-3-12(4-6-13)7-8-21-15(17)18/h3-6,14,16H,7-10H2,1-2H3,(H3,17,18)/b16-11+/t14-/m1/s1 |
| InChIKey | KGQFWDOUOXBKPA-DSQDWWTGSA-N |
| XLogP | 2.71 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|