C14H17N3S3 — CID 169053158
2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]phenyl]ethyl carbamimidothioate (PubChem CID 169053158) has the molecular formula C14H17N3S3 and a molecular weight of 323.51 g/mol. Its IUPAC name is 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]phenyl]ethyl carbamimidothioate.
| Compound Name | 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]phenyl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 169053158 |
| Molecular Formula | C14H17N3S3 |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]phenyl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccc(CCSc2nccs2)cc1 |
| InChI | InChI=1S/C14H17N3S3/c15-13(16)18-8-5-11-1-3-12(4-2-11)6-9-19-14-17-7-10-20-14/h1-4,7,10H,5-6,8-9H2,(H3,15,16) |
| InChIKey | OHKWMYPAZSTFLA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|