C19H19N — CID 176754936
(2Z,4E)-2,5-diphenyl-3-(trideuteriomethyl)hexa-2,4-dien-1-imine (PubChem CID 176754936) has the molecular formula C19H19N and a molecular weight of 264.39 g/mol. Its IUPAC name is (2Z,4E)-2,5-diphenyl-3-(trideuteriomethyl)hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-2,5-diphenyl-3-(trideuteriomethyl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 176754936 |
| Molecular Formula | C19H19N |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2Z,4E)-2,5-diphenyl-3-(trideuteriomethyl)hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C(\C=C(/C)c1ccccc1)C([2H])([2H])[2H])c1ccccc1 |
| InChI | InChI=1S/C19H19N/c1-15(17-9-5-3-6-10-17)13-16(2)19(14-20)18-11-7-4-8-12-18/h3-14,20H,1-2H3/b15-13+,19-16+,20-14+/i2D3 |
| InChIKey | DEZHQOAJUUSGEX-DWFSPVBISA-N |
| XLogP | 5.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|