C27H33N — CID 166503018
(2E,4E)-3-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-5-phenylhexa-2,4-dien-1-imine (PubChem CID 166503018) has the molecular formula C27H33N and a molecular weight of 372.57 g/mol. Its IUPAC name is (2E,4E)-3-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-5-phenylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4E)-3-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-5-phenylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166503018 |
| Molecular Formula | C27H33N |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (2E,4E)-3-[4-(1-deuterio-3,3,4,4-tetramethylcyclopentyl)phenyl]-5-phenylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(\C=C(/C)c1ccccc1)c1ccc(C2([2H])CC(C)(C)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C27H33N/c1-20(21-9-7-6-8-10-21)17-24(15-16-28)22-11-13-23(14-12-22)25-18-26(2,3)27(4,5)19-25/h6-17,25,28H,18-19H2,1-5H3/b20-17+,24-15+,28-16+/i25D |
| InChIKey | FLSAVBRGRTZXIW-QRGRAMDCSA-N |
| XLogP | 7.75 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|