C21H33NO — CID 142350882
ethane;(2E,4E)-4-methoxy-2,7-dimethyl-6-phenylocta-2,4,6-trien-1-imine (PubChem CID 142350882) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is ethane;(2E,4E)-4-methoxy-2,7-dimethyl-6-phenylocta-2,4,6-trien-1-imine.
| Compound Name | ethane;(2E,4E)-4-methoxy-2,7-dimethyl-6-phenylocta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 142350882 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | ethane;(2E,4E)-4-methoxy-2,7-dimethyl-6-phenylocta-2,4,6-trien-1-imine |
| SMILES | CC.CC.[H]/N=C/C(C)=C/C(=C\C(=C(C)C)c1ccccc1)OC |
| InChI | InChI=1S/C17H21NO.2C2H6/c1-13(2)17(15-8-6-5-7-9-15)11-16(19-4)10-14(3)12-18;2*1-2/h5-12,18H,1-4H3;2*1-2H3/b14-10+,16-11+,18-12+;; |
| InChIKey | NJZGAQWSBHLWCM-ZNAUUGHXSA-N |
| XLogP | 6.66 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|