C10H10N2 — CID 143908274
N-[(1E)-2-pyridin-3-ylbuta-1,3-dienyl]methanimine (PubChem CID 143908274) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is N-[(1E)-2-pyridin-3-ylbuta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E)-2-pyridin-3-ylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143908274 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | N-[(1E)-2-pyridin-3-ylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C(=C\N=C)c1cccnc1 |
| InChI | InChI=1S/C10H10N2/c1-3-9(7-11-2)10-5-4-6-12-8-10/h3-8H,1-2H2/b9-7+ |
| InChIKey | NRKGBPKVLHZZKV-VQHVLOKHSA-N |
| XLogP | 2.31 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|