C9H10N2 — CID 142226114
(1Z)-3-pyridin-3-ylbuta-1,3-dien-1-amine (PubChem CID 142226114) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (1Z)-3-pyridin-3-ylbuta-1,3-dien-1-amine.
| Compound Name | (1Z)-3-pyridin-3-ylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142226114 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (1Z)-3-pyridin-3-ylbuta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\N)c1cccnc1 |
| InChI | InChI=1S/C9H10N2/c1-8(4-5-10)9-3-2-6-11-7-9/h2-7H,1,10H2/b5-4- |
| InChIKey | JMQUOFXLBJPBNS-PLNGDYQASA-N |
| XLogP | 1.57 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|