C12H12F3N — CID 143483764
3-[(3E)-4-(trifluoromethyl)hexa-1,3-dien-2-yl]pyridine (PubChem CID 143483764) has the molecular formula C12H12F3N and a molecular weight of 227.23 g/mol. Its IUPAC name is 3-[(3E)-4-(trifluoromethyl)hexa-1,3-dien-2-yl]pyridine.
| Compound Name | 3-[(3E)-4-(trifluoromethyl)hexa-1,3-dien-2-yl]pyridine |
|---|---|
| PubChem CID | 143483764 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-[(3E)-4-(trifluoromethyl)hexa-1,3-dien-2-yl]pyridine |
| SMILES | C=C(/C=C(\CC)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C12H12F3N/c1-3-11(12(13,14)15)7-9(2)10-5-4-6-16-8-10/h4-8H,2-3H2,1H3/b11-7+ |
| InChIKey | WTIZKWWXGJAJAS-YRNVUSSQSA-N |
| XLogP | 3.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|