C25H26F4N4O — CID 143484630
ethane;2-fluoro-N-(5-methyl-2-pyridinyl)pyridine-4-carboxamide;3-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]pyridine (PubChem CID 143484630) has the molecular formula C25H26F4N4O and a molecular weight of 474.50 g/mol. Its IUPAC name is ethane;2-fluoro-N-(5-methyl-2-pyridinyl)pyridine-4-carboxamide;3-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]pyridine.
| Compound Name | ethane;2-fluoro-N-(5-methyl-2-pyridinyl)pyridine-4-carboxamide;3-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]pyridine |
|---|---|
| PubChem CID | 143484630 |
| Molecular Formula | C25H26F4N4O |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | ethane;2-fluoro-N-(5-methyl-2-pyridinyl)pyridine-4-carboxamide;3-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]pyridine |
| SMILES | C=C(/C=C(\C)C(F)(F)F)c1cccnc1.CC.Cc1ccc(NC(=O)c2ccnc(F)c2)nc1 |
| InChI | InChI=1S/C12H10FN3O.C11H10F3N.C2H6/c1-8-2-3-11(15-7-8)16-12(17)9-4-5-14-10(13)6-9;1-8(6-9(2)11(12,13)14)10-4-3-5-15-7-10;1-2/h2-7H,1H3,(H,15,16,17);3-7H,1H2,2H3;1-2H3/b;9-6+; |
| InChIKey | VEMBXHJIBQNNGG-YJXWIHHLSA-N |
| XLogP | 6.81 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|