C18H21N3O2 — CID 35344360
3-(2,2-dimethylpropanoylamino)-N-(5-methyl-2-pyridinyl)benzamide (PubChem CID 35344360) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylamino)-N-(5-methyl-2-pyridinyl)benzamide.
| Compound Name | 3-(2,2-dimethylpropanoylamino)-N-(5-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 35344360 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-(2,2-dimethylpropanoylamino)-N-(5-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(NC(=O)C(C)(C)C)c2)nc1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-8-9-15(19-11-12)21-16(22)13-6-5-7-14(10-13)20-17(23)18(2,3)4/h5-11H,1-4H3,(H,20,23)(H,19,21,22) |
| InChIKey | MBPGSYJWIKXJSH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |