C19H21NO2 — CID 143746919
3-[[4-[(3Z)-4-methoxyhexa-1,3-dien-2-yl]phenyl]methoxy]pyridine (PubChem CID 143746919) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[[4-[(3Z)-4-methoxyhexa-1,3-dien-2-yl]phenyl]methoxy]pyridine.
| Compound Name | 3-[[4-[(3Z)-4-methoxyhexa-1,3-dien-2-yl]phenyl]methoxy]pyridine |
|---|---|
| PubChem CID | 143746919 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3-[[4-[(3Z)-4-methoxyhexa-1,3-dien-2-yl]phenyl]methoxy]pyridine |
| SMILES | C=C(/C=C(/CC)OC)c1ccc(COc2cccnc2)cc1 |
| InChI | InChI=1S/C19H21NO2/c1-4-18(21-3)12-15(2)17-9-7-16(8-10-17)14-22-19-6-5-11-20-13-19/h5-13H,2,4,14H2,1,3H3/b18-12- |
| InChIKey | RGYKBANOFFMARQ-PDGQHHTCSA-N |
| XLogP | 4.61 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|