About N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide
N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide (PubChem CID 148611727) has the molecular formula C11H10BrN3O
and a molecular weight of 280.13 g/mol. Its IUPAC name is N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide.
Molecular Properties
| Compound Name | N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide |
| PubChem CID | 148611727 |
| Molecular Formula | C11H10BrN3O |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide |
| SMILES | C=CN(C=C)/C(Br)=N/C(=O)c1cccnc1 |
| InChI | InChI=1S/C11H10BrN3O/c1-3-15(4-2)11(12)14-10(16)9-6-5-7-13-8-9/h3-8H,1-2H2/b14-11+ |
| InChIKey | NEMVTXRIHLYPAC-SDNWHVSQSA-N |
| XLogP | 2.56 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide?
The IUPAC name of N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide (CID 148611727) is N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide.
What is the SMILES notation for N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide?
The canonical SMILES for N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide is C=CN(C=C)/C(Br)=N/C(=O)c1cccnc1.
What is the InChIKey of N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide?
The InChIKey is NEMVTXRIHLYPAC-SDNWHVSQSA-N. The full InChI is InChI=1S/C11H10BrN3O/c1-3-15(4-2)11(12)14-10(16)9-6-5-7-13-8-9/h3-8H,1-2H2/b14-11+.
What are the key properties of N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide?
N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide has a molecular weight of 280.13 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(ethenyl)-N'-(pyridine-3-carbonyl)carbamimidoyl bromide is sourced from PubChem (CID 148611727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).