About formonitrile;1-pyridin-3-ylethanone
formonitrile;1-pyridin-3-ylethanone (PubChem CID 174750729) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is formonitrile;1-pyridin-3-ylethanone.
Molecular Properties
| Compound Name | formonitrile;1-pyridin-3-ylethanone |
| PubChem CID | 174750729 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | formonitrile;1-pyridin-3-ylethanone |
| SMILES | C#N.CC(=O)c1cccnc1 |
| InChI | InChI=1S/C7H7NO.CHN/c1-6(9)7-3-2-4-8-5-7;1-2/h2-5H,1H3;1H |
| InChIKey | SHCMOSKZOVNUTR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formonitrile;1-pyridin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;1-pyridin-3-ylethanone?
The IUPAC name of formonitrile;1-pyridin-3-ylethanone (CID 174750729) is formonitrile;1-pyridin-3-ylethanone.
What is the SMILES notation for formonitrile;1-pyridin-3-ylethanone?
The canonical SMILES for formonitrile;1-pyridin-3-ylethanone is C#N.CC(=O)c1cccnc1.
What is the InChIKey of formonitrile;1-pyridin-3-ylethanone?
The InChIKey is SHCMOSKZOVNUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.CHN/c1-6(9)7-3-2-4-8-5-7;1-2/h2-5H,1H3;1H.
What are the key properties of formonitrile;1-pyridin-3-ylethanone?
formonitrile;1-pyridin-3-ylethanone has a molecular weight of 148.16 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;1-pyridin-3-ylethanone is sourced from PubChem (CID 174750729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).