About (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone
(Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone (PubChem CID 159777179) has the molecular formula C17H18N2O2S
and a molecular weight of 314.41 g/mol. Its IUPAC name is (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone.
Molecular Properties
| Compound Name | (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone |
| PubChem CID | 159777179 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone |
| SMILES | CC(=O)c1cccnc1.CS/C(C)=C\C(=O)c1cccnc1 |
| InChI | InChI=1S/C10H11NOS.C7H7NO/c1-8(13-2)6-10(12)9-4-3-5-11-7-9;1-6(9)7-3-2-4-8-5-7/h3-7H,1-2H3;2-5H,1H3/b8-6-; |
| InChIKey | NGWWVMPRBSNRCW-PHZXCRFESA-N |
| XLogP | 3.82 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone?
The IUPAC name of (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone (CID 159777179) is (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone.
What is the SMILES notation for (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone?
The canonical SMILES for (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone is CC(=O)c1cccnc1.CS/C(C)=C\C(=O)c1cccnc1.
What is the InChIKey of (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone?
The InChIKey is NGWWVMPRBSNRCW-PHZXCRFESA-N. The full InChI is InChI=1S/C10H11NOS.C7H7NO/c1-8(13-2)6-10(12)9-4-3-5-11-7-9;1-6(9)7-3-2-4-8-5-7/h3-7H,1-2H3;2-5H,1H3/b8-6-;.
What are the key properties of (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone?
(Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone has a molecular weight of 314.41 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methylsulfanyl-1-pyridin-3-ylbut-2-en-1-one;1-pyridin-3-ylethanone is sourced from PubChem (CID 159777179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).