About dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone
dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone (PubChem CID 160688200) has the molecular formula C19H22N2O7
and a molecular weight of 390.39 g/mol. Its IUPAC name is dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone.
Molecular Properties
| Compound Name | dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone |
| PubChem CID | 160688200 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone |
| SMILES | CC(=O)c1cccnc1.COC(=O)CC(=O)c1cccnc1.COC(=O)OC |
| InChI | InChI=1S/C9H9NO3.C7H7NO.C3H6O3/c1-13-9(12)5-8(11)7-3-2-4-10-6-7;1-6(9)7-3-2-4-8-5-7;1-5-3(4)6-2/h2-4,6H,5H2,1H3;2-5H,1H3;1-2H3 |
| InChIKey | RPBAMPUDEJKTSQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 121.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone?
The IUPAC name of dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone (CID 160688200) is dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone.
What is the SMILES notation for dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone?
The canonical SMILES for dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone is CC(=O)c1cccnc1.COC(=O)CC(=O)c1cccnc1.COC(=O)OC.
What is the InChIKey of dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone?
The InChIKey is RPBAMPUDEJKTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.C7H7NO.C3H6O3/c1-13-9(12)5-8(11)7-3-2-4-10-6-7;1-6(9)7-3-2-4-8-5-7;1-5-3(4)6-2/h2-4,6H,5H2,1H3;2-5H,1H3;1-2H3.
What are the key properties of dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone?
dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone has a molecular weight of 390.39 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl carbonate;methyl 3-oxo-3-pyridin-3-ylpropanoate;1-pyridin-3-ylethanone is sourced from PubChem (CID 160688200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).