C15H12ClNO3 — CID 58626094
1-(3-chloro-4-methoxyphenyl)-3-pyridin-3-ylpropane-1,3-dione (PubChem CID 58626094) has the molecular formula C15H12ClNO3 and a molecular weight of 289.72 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-pyridin-3-ylpropane-1,3-dione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-pyridin-3-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 58626094 |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-pyridin-3-ylpropane-1,3-dione |
| SMILES | COc1ccc(C(=O)CC(=O)c2cccnc2)cc1Cl |
| InChI | InChI=1S/C15H12ClNO3/c1-20-15-5-4-10(7-12(15)16)13(18)8-14(19)11-3-2-6-17-9-11/h2-7,9H,8H2,1H3 |
| InChIKey | IAVWPNWHGZKBDF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|