C11H9ClO5 — CID 10422570
4-(3-chloro-4-methoxyphenyl)-2,4-dioxobutanoic acid (PubChem CID 10422570) has the molecular formula C11H9ClO5 and a molecular weight of 256.64 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 10422570 |
| Molecular Formula | C11H9ClO5 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)-2,4-dioxobutanoic acid |
| SMILES | COc1ccc(C(=O)CC(=O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H9ClO5/c1-17-10-3-2-6(4-7(10)12)8(13)5-9(14)11(15)16/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | KRXVGLXRDGNKNB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|