About CID 131854915
CID 131854915 (PubChem CID 131854915) has the molecular formula C6H5N2O
and a molecular weight of 121.12 g/mol.
Molecular Properties
| Compound Name | CID 131854915 |
| PubChem CID | 131854915 |
| Molecular Formula | C6H5N2O |
| Molecular Weight | 121.12 g/mol |
| Exact Mass | 121.04 |
| IUPAC Name | — |
| SMILES | [NH]C(=O)c1cccnc1 |
| InChI | InChI=1S/C6H5N2O/c7-6(9)5-2-1-3-8-4-5/h1-4,7H |
| InChIKey | NJGWGRKBJVHVCH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.12 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 131854915 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131854915?
The IUPAC name of CID 131854915 (CID 131854915) is not available.
What is the SMILES notation for CID 131854915?
The canonical SMILES for CID 131854915 is [NH]C(=O)c1cccnc1.
What is the InChIKey of CID 131854915?
The InChIKey is NJGWGRKBJVHVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N2O/c7-6(9)5-2-1-3-8-4-5/h1-4,7H.
What are the key properties of CID 131854915?
CID 131854915 has a molecular weight of 121.12 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131854915 is sourced from PubChem (CID 131854915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).