About neodymium(3+);pyridine-3-carboxylate
neodymium(3+);pyridine-3-carboxylate (PubChem CID 23619365) has the molecular formula C6H4NNdO2+2
and a molecular weight of 266.34 g/mol. Its IUPAC name is neodymium(3+);pyridine-3-carboxylate.
Molecular Properties
| Compound Name | neodymium(3+);pyridine-3-carboxylate |
| PubChem CID | 23619365 |
| Molecular Formula | C6H4NNdO2+2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 263.93 |
| IUPAC Name | neodymium(3+);pyridine-3-carboxylate |
| SMILES | O=C([O-])c1cccnc1.[Nd+3] |
| InChI | InChI=1S/C6H5NO2.Nd/c8-6(9)5-2-1-3-7-4-5;/h1-4H,(H,8,9);/q;+3/p-1 |
| InChIKey | VECZBFQEYBDUAE-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze neodymium(3+);pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neodymium(3+);pyridine-3-carboxylate?
The IUPAC name of neodymium(3+);pyridine-3-carboxylate (CID 23619365) is neodymium(3+);pyridine-3-carboxylate.
What is the SMILES notation for neodymium(3+);pyridine-3-carboxylate?
The canonical SMILES for neodymium(3+);pyridine-3-carboxylate is O=C([O-])c1cccnc1.[Nd+3].
What is the InChIKey of neodymium(3+);pyridine-3-carboxylate?
The InChIKey is VECZBFQEYBDUAE-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2.Nd/c8-6(9)5-2-1-3-7-4-5;/h1-4H,(H,8,9);/q;+3/p-1.
What are the key properties of neodymium(3+);pyridine-3-carboxylate?
neodymium(3+);pyridine-3-carboxylate has a molecular weight of 266.34 g/mol, XLogP of -0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for neodymium(3+);pyridine-3-carboxylate is sourced from PubChem (CID 23619365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).