About 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate
5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate (PubChem CID 139078518) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate |
| PubChem CID | 139078518 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate |
| SMILES | Cc1ccc(N)[nH+]c1.O=C([O-])c1cccnc1 |
| InChI | InChI=1S/C6H8N2.C6H5NO2/c1-5-2-3-6(7)8-4-5;8-6(9)5-2-1-3-7-4-5/h2-4H,1H3,(H2,7,8);1-4H,(H,8,9) |
| InChIKey | JDPQEMGFZXAVGV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate?
The IUPAC name of 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate (CID 139078518) is 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate.
What is the SMILES notation for 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate?
The canonical SMILES for 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate is Cc1ccc(N)[nH+]c1.O=C([O-])c1cccnc1.
What is the InChIKey of 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate?
The InChIKey is JDPQEMGFZXAVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C6H5NO2/c1-5-2-3-6(7)8-4-5;8-6(9)5-2-1-3-7-4-5/h2-4H,1H3,(H2,7,8);1-4H,(H,8,9).
What are the key properties of 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate?
5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate has a molecular weight of 231.25 g/mol, XLogP of -0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyridin-1-ium-2-amine;pyridine-3-carboxylate is sourced from PubChem (CID 139078518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).