About N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate
N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate (PubChem CID 22353992) has the molecular formula C12H11N4O3-
and a molecular weight of 259.25 g/mol. Its IUPAC name is N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate.
Molecular Properties
| Compound Name | N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate |
| PubChem CID | 22353992 |
| Molecular Formula | C12H11N4O3- |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate |
| SMILES | N/C(=N\O)c1cccnc1.O=C([O-])c1cccnc1 |
| InChI | InChI=1S/C6H7N3O.C6H5NO2/c7-6(9-10)5-2-1-3-8-4-5;8-6(9)5-2-1-3-7-4-5/h1-4,10H,(H2,7,9);1-4H,(H,8,9)/p-1 |
| InChIKey | LODZMBGWSGGEFB-UHFFFAOYSA-M |
| XLogP | -0.38 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate?
The IUPAC name of N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate (CID 22353992) is N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate.
What is the SMILES notation for N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate?
The canonical SMILES for N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate is N/C(=N\O)c1cccnc1.O=C([O-])c1cccnc1.
What is the InChIKey of N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate?
The InChIKey is LODZMBGWSGGEFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7N3O.C6H5NO2/c7-6(9-10)5-2-1-3-8-4-5;8-6(9)5-2-1-3-7-4-5/h1-4,10H,(H2,7,9);1-4H,(H,8,9)/p-1.
What are the key properties of N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate?
N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate has a molecular weight of 259.25 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxypyridine-3-carboximidamide;pyridine-3-carboxylate is sourced from PubChem (CID 22353992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).