About bis(pyridine-3-carboxylate);ruthenium(2+)
bis(pyridine-3-carboxylate);ruthenium(2+) (PubChem CID 87535471) has the molecular formula C12H8N2O4Ru
and a molecular weight of 345.28 g/mol. Its IUPAC name is bis(pyridine-3-carboxylate);ruthenium(2+).
Molecular Properties
| Compound Name | bis(pyridine-3-carboxylate);ruthenium(2+) |
| PubChem CID | 87535471 |
| Molecular Formula | C12H8N2O4Ru |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | bis(pyridine-3-carboxylate);ruthenium(2+) |
| SMILES | O=C([O-])c1cccnc1.O=C([O-])c1cccnc1.[Ru+2] |
| InChI | InChI=1S/2C6H5NO2.Ru/c2*8-6(9)5-2-1-3-7-4-5;/h2*1-4H,(H,8,9);/q;;+2/p-2 |
| InChIKey | HZZAKVINTFTHKR-UHFFFAOYSA-L |
| XLogP | -1.11 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(pyridine-3-carboxylate);ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(pyridine-3-carboxylate);ruthenium(2+)?
The IUPAC name of bis(pyridine-3-carboxylate);ruthenium(2+) (CID 87535471) is bis(pyridine-3-carboxylate);ruthenium(2+).
What is the SMILES notation for bis(pyridine-3-carboxylate);ruthenium(2+)?
The canonical SMILES for bis(pyridine-3-carboxylate);ruthenium(2+) is O=C([O-])c1cccnc1.O=C([O-])c1cccnc1.[Ru+2].
What is the InChIKey of bis(pyridine-3-carboxylate);ruthenium(2+)?
The InChIKey is HZZAKVINTFTHKR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5NO2.Ru/c2*8-6(9)5-2-1-3-7-4-5;/h2*1-4H,(H,8,9);/q;;+2/p-2.
What are the key properties of bis(pyridine-3-carboxylate);ruthenium(2+)?
bis(pyridine-3-carboxylate);ruthenium(2+) has a molecular weight of 345.28 g/mol, XLogP of -1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(pyridine-3-carboxylate);ruthenium(2+) is sourced from PubChem (CID 87535471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).