C11H16N2O4 — CID 169075412
[(2R)-2-carboxybutan-2-yl]azanium;pyridine-3-carboxylate (PubChem CID 169075412) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is [(2R)-2-carboxybutan-2-yl]azanium;pyridine-3-carboxylate.
| Compound Name | [(2R)-2-carboxybutan-2-yl]azanium;pyridine-3-carboxylate |
|---|---|
| PubChem CID | 169075412 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [(2R)-2-carboxybutan-2-yl]azanium;pyridine-3-carboxylate |
| SMILES | CC[C@@](C)([NH3+])C(=O)O.O=C([O-])c1cccnc1 |
| InChI | InChI=1S/C6H5NO2.C5H11NO2/c8-6(9)5-2-1-3-7-4-5;1-3-5(2,6)4(7)8/h1-4H,(H,8,9);3,6H2,1-2H3,(H,7,8)/t;5-/m.1/s1 |
| InChIKey | HUYKWTZZTZFQJF-QDXATWJZSA-N |
| XLogP | -1.07 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |