About 6-iodohexa-3,5-dien-1-yn-3-ylbenzene
6-iodohexa-3,5-dien-1-yn-3-ylbenzene (PubChem CID 71377976) has the molecular formula C12H9I
and a molecular weight of 280.11 g/mol. Its IUPAC name is 6-iodohexa-3,5-dien-1-yn-3-ylbenzene.
Molecular Properties
| Compound Name | 6-iodohexa-3,5-dien-1-yn-3-ylbenzene |
| PubChem CID | 71377976 |
| Molecular Formula | C12H9I |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 6-iodohexa-3,5-dien-1-yn-3-ylbenzene |
| SMILES | C#CC(=CC=CI)c1ccccc1 |
| InChI | InChI=1S/C12H9I/c1-2-11(9-6-10-13)12-7-4-3-5-8-12/h1,3-10H |
| InChIKey | PYCRXCCNOOGHDO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-iodohexa-3,5-dien-1-yn-3-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodohexa-3,5-dien-1-yn-3-ylbenzene?
The IUPAC name of 6-iodohexa-3,5-dien-1-yn-3-ylbenzene (CID 71377976) is 6-iodohexa-3,5-dien-1-yn-3-ylbenzene.
What is the SMILES notation for 6-iodohexa-3,5-dien-1-yn-3-ylbenzene?
The canonical SMILES for 6-iodohexa-3,5-dien-1-yn-3-ylbenzene is C#CC(=CC=CI)c1ccccc1.
What is the InChIKey of 6-iodohexa-3,5-dien-1-yn-3-ylbenzene?
The InChIKey is PYCRXCCNOOGHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9I/c1-2-11(9-6-10-13)12-7-4-3-5-8-12/h1,3-10H.
What are the key properties of 6-iodohexa-3,5-dien-1-yn-3-ylbenzene?
6-iodohexa-3,5-dien-1-yn-3-ylbenzene has a molecular weight of 280.11 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodohexa-3,5-dien-1-yn-3-ylbenzene is sourced from PubChem (CID 71377976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).