C21H22FNO — CID 145272727
ethane;(2Z)-2-[2-(3-fluorodibenzofuran-4-yl)ethylidene]pent-4-en-1-imine (PubChem CID 145272727) has the molecular formula C21H22FNO and a molecular weight of 323.41 g/mol. Its IUPAC name is ethane;(2Z)-2-[2-(3-fluorodibenzofuran-4-yl)ethylidene]pent-4-en-1-imine.
| Compound Name | ethane;(2Z)-2-[2-(3-fluorodibenzofuran-4-yl)ethylidene]pent-4-en-1-imine |
|---|---|
| PubChem CID | 145272727 |
| Molecular Formula | C21H22FNO |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | ethane;(2Z)-2-[2-(3-fluorodibenzofuran-4-yl)ethylidene]pent-4-en-1-imine |
| SMILES | CC.[H]/N=C/C(=C\Cc1c(F)ccc2c1oc1ccccc12)CC=C |
| InChI | InChI=1S/C19H16FNO.C2H6/c1-2-5-13(12-21)8-9-16-17(20)11-10-15-14-6-3-4-7-18(14)22-19(15)16;1-2/h2-4,6-8,10-12,21H,1,5,9H2;1-2H3/b13-8-,21-12+; |
| InChIKey | ZOABUJRPCZATRV-OQDPWZCASA-N |
| XLogP | 6.45 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|