C31H32FNO — CID 144857274
1-fluoro-2-[(3E,5Z)-octa-3,5-dien-3-yl]benzene;(Z)-4-(3-methyldibenzofuran-4-yl)but-2-en-1-imine (PubChem CID 144857274) has the molecular formula C31H32FNO and a molecular weight of 453.60 g/mol. Its IUPAC name is 1-fluoro-2-[(3E,5Z)-octa-3,5-dien-3-yl]benzene;(Z)-4-(3-methyldibenzofuran-4-yl)but-2-en-1-imine.
| Compound Name | 1-fluoro-2-[(3E,5Z)-octa-3,5-dien-3-yl]benzene;(Z)-4-(3-methyldibenzofuran-4-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 144857274 |
| Molecular Formula | C31H32FNO |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 1-fluoro-2-[(3E,5Z)-octa-3,5-dien-3-yl]benzene;(Z)-4-(3-methyldibenzofuran-4-yl)but-2-en-1-imine |
| SMILES | CC/C=C\C=C(/CC)c1ccccc1F.[H]/N=C/C=C\Cc1c(C)ccc2c1oc1ccccc12 |
| InChI | InChI=1S/C17H15NO.C14H17F/c1-12-9-10-15-14-7-2-3-8-16(14)19-17(15)13(12)6-4-5-11-18;1-3-5-6-9-12(4-2)13-10-7-8-11-14(13)15/h2-5,7-11,18H,6H2,1H3;5-11H,3-4H2,1-2H3/b5-4-,18-11+;6-5-,12-9+ |
| InChIKey | XTAAVZZQIBENOV-XOLJBPLLSA-N |
| XLogP | 9.23 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|