C31H34N2O — CID 145258762
(Z)-4-dibenzofuran-4-ylbut-2-en-1-imine;1-methyl-2-(2-methylphenyl)pyrrole;propane (PubChem CID 145258762) has the molecular formula C31H34N2O and a molecular weight of 450.63 g/mol. Its IUPAC name is (Z)-4-dibenzofuran-4-ylbut-2-en-1-imine;1-methyl-2-(2-methylphenyl)pyrrole;propane.
| Compound Name | (Z)-4-dibenzofuran-4-ylbut-2-en-1-imine;1-methyl-2-(2-methylphenyl)pyrrole;propane |
|---|---|
| PubChem CID | 145258762 |
| Molecular Formula | C31H34N2O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | (Z)-4-dibenzofuran-4-ylbut-2-en-1-imine;1-methyl-2-(2-methylphenyl)pyrrole;propane |
| SMILES | CCC.Cc1ccccc1-c1cccn1C.[H]/N=C/C=C\Cc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C16H13NO.C12H13N.C3H8/c17-11-4-3-6-12-7-5-9-14-13-8-1-2-10-15(13)18-16(12)14;1-10-6-3-4-7-11(10)12-8-5-9-13(12)2;1-3-2/h1-5,7-11,17H,6H2;3-9H,1-2H3;3H2,1-2H3/b4-3-,17-11+;; |
| InChIKey | CXGKJUMHQLCCHM-AOHXEFDNSA-N |
| XLogP | 8.75 |
| TPSA | 41.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|