About 4-methyldibenzofuran;(Z)-pent-3-en-2-imine
4-methyldibenzofuran;(Z)-pent-3-en-2-imine (PubChem CID 145299521) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-methyldibenzofuran;(Z)-pent-3-en-2-imine.
Molecular Properties
| Compound Name | 4-methyldibenzofuran;(Z)-pent-3-en-2-imine |
| PubChem CID | 145299521 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-methyldibenzofuran;(Z)-pent-3-en-2-imine |
| SMILES | Cc1cccc2c1oc1ccccc12.[H]/N=C(C)/C=C\C |
| InChI | InChI=1S/C13H10O.C5H9N/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;1-3-4-5(2)6/h2-8H,1H3;3-4,6H,1-2H3/b;4-3-,6-5+ |
| InChIKey | XQYTXZCGPWMPCY-YOTQJPDSSA-N |
| XLogP | 5.50 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyldibenzofuran;(Z)-pent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyldibenzofuran;(Z)-pent-3-en-2-imine?
The IUPAC name of 4-methyldibenzofuran;(Z)-pent-3-en-2-imine (CID 145299521) is 4-methyldibenzofuran;(Z)-pent-3-en-2-imine.
What is the SMILES notation for 4-methyldibenzofuran;(Z)-pent-3-en-2-imine?
The canonical SMILES for 4-methyldibenzofuran;(Z)-pent-3-en-2-imine is Cc1cccc2c1oc1ccccc12.[H]/N=C(C)/C=C\C.
What is the InChIKey of 4-methyldibenzofuran;(Z)-pent-3-en-2-imine?
The InChIKey is XQYTXZCGPWMPCY-YOTQJPDSSA-N. The full InChI is InChI=1S/C13H10O.C5H9N/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;1-3-4-5(2)6/h2-8H,1H3;3-4,6H,1-2H3/b;4-3-,6-5+.
What are the key properties of 4-methyldibenzofuran;(Z)-pent-3-en-2-imine?
4-methyldibenzofuran;(Z)-pent-3-en-2-imine has a molecular weight of 265.36 g/mol, XLogP of 5.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyldibenzofuran;(Z)-pent-3-en-2-imine is sourced from PubChem (CID 145299521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).