About ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran
ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran (PubChem CID 142201060) has the molecular formula C27H29NO
and a molecular weight of 383.54 g/mol. Its IUPAC name is ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran.
Molecular Properties
| Compound Name | ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran |
| PubChem CID | 142201060 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran |
| SMILES | CC.CCc1ccccc1-n1cccc1.Cc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C13H10O.C12H13N.C2H6/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;1-2-11-7-3-4-8-12(11)13-9-5-6-10-13;1-2/h2-8H,1H3;3-10H,2H2,1H3;1-2H3 |
| InChIKey | KJSTZULXTZHVAB-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran?
The IUPAC name of ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran (CID 142201060) is ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran.
What is the SMILES notation for ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran?
The canonical SMILES for ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran is CC.CCc1ccccc1-n1cccc1.Cc1cccc2c1oc1ccccc12.
What is the InChIKey of ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran?
The InChIKey is KJSTZULXTZHVAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C12H13N.C2H6/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;1-2-11-7-3-4-8-12(11)13-9-5-6-10-13;1-2/h2-8H,1H3;3-10H,2H2,1H3;1-2H3.
What are the key properties of ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran?
ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran has a molecular weight of 383.54 g/mol, XLogP of 7.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-ethylphenyl)pyrrole;4-methyldibenzofuran is sourced from PubChem (CID 142201060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).