C18H17NO — CID 145027861
N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]dibenzofuran-4-amine (PubChem CID 145027861) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]dibenzofuran-4-amine.
| Compound Name | N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 145027861 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]dibenzofuran-4-amine |
| SMILES | C/C=C(C)\C=C/Nc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C18H17NO/c1-3-13(2)11-12-19-16-9-6-8-15-14-7-4-5-10-17(14)20-18(15)16/h3-12,19H,1-2H3/b12-11-,13-3- |
| InChIKey | UABRZYPWYGXPOK-ZWTPQFIZSA-N |
| XLogP | 5.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|