C19H19NO — CID 145212273
N-[(1Z,3Z)-3-methylhexa-1,3-dienyl]dibenzofuran-4-amine (PubChem CID 145212273) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-methylhexa-1,3-dienyl]dibenzofuran-4-amine.
| Compound Name | N-[(1Z,3Z)-3-methylhexa-1,3-dienyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 145212273 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[(1Z,3Z)-3-methylhexa-1,3-dienyl]dibenzofuran-4-amine |
| SMILES | CC/C=C(C)\C=C/Nc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C19H19NO/c1-3-7-14(2)12-13-20-17-10-6-9-16-15-8-4-5-11-18(15)21-19(16)17/h4-13,20H,3H2,1-2H3/b13-12-,14-7- |
| InChIKey | NHWDAOJLPWKKOT-LRRHXLOMSA-N |
| XLogP | 5.87 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|