C26H27NO — CID 145027907
ethane;N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]dibenzofuran-4-amine (PubChem CID 145027907) has the molecular formula C26H27NO and a molecular weight of 369.51 g/mol. Its IUPAC name is ethane;N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]dibenzofuran-4-amine.
| Compound Name | ethane;N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 145027907 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | ethane;N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]dibenzofuran-4-amine |
| SMILES | C/C=C(\C=C/Nc1cccc2c1oc1ccccc12)c1ccc(C)cc1.CC |
| InChI | InChI=1S/C24H21NO.C2H6/c1-3-18(19-13-11-17(2)12-14-19)15-16-25-22-9-6-8-21-20-7-4-5-10-23(20)26-24(21)22;1-2/h3-16,25H,1-2H3;1-2H3/b16-15-,18-3+; |
| InChIKey | JZDQFLUKLWPLKM-FWOPVJJNSA-N |
| XLogP | 7.95 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|