C31H26O — CID 142519053
1-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]-4-methyldibenzofuran (PubChem CID 142519053) has the molecular formula C31H26O and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]-4-methyldibenzofuran.
| Compound Name | 1-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]-4-methyldibenzofuran |
|---|---|
| PubChem CID | 142519053 |
| Molecular Formula | C31H26O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]-4-methyldibenzofuran |
| SMILES | C/C=C\C(=C/C)c1cccc(-c2cccc(-c3ccc(C)c4oc5ccccc5c34)c2)c1 |
| InChI | InChI=1S/C31H26O/c1-4-10-22(5-2)23-11-8-12-24(19-23)25-13-9-14-26(20-25)27-18-17-21(3)31-30(27)28-15-6-7-16-29(28)32-31/h4-20H,1-3H3/b10-4-,22-5+ |
| InChIKey | VGNJKHFJAWPHSW-PYCRUENISA-N |
| XLogP | 9.21 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|