C39H25N3O — CID 130289437
2,4-diphenyl-6-[3-(4-phenyldibenzofuran-1-yl)phenyl]-1,3,5-triazine (PubChem CID 130289437) has the molecular formula C39H25N3O and a molecular weight of 551.65 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-(4-phenyldibenzofuran-1-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-(4-phenyldibenzofuran-1-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130289437 |
| Molecular Formula | C39H25N3O |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2,4-diphenyl-6-[3-(4-phenyldibenzofuran-1-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc(-c5ccccc5)c5oc6ccccc6c45)c3)n2)cc1 |
| InChI | InChI=1S/C39H25N3O/c1-4-13-26(14-5-1)32-24-23-31(35-33-21-10-11-22-34(33)43-36(32)35)29-19-12-20-30(25-29)39-41-37(27-15-6-2-7-16-27)40-38(42-39)28-17-8-3-9-18-28/h1-25H |
| InChIKey | SNUFAGQWCSMDHY-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |