C57H33N3O3 — CID 155077748
2-dibenzofuran-3-yl-4-[4-(4-dibenzofuran-3-yldibenzofuran-1-yl)phenyl]-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 155077748) has the molecular formula C57H33N3O3 and a molecular weight of 807.91 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-[4-(4-dibenzofuran-3-yldibenzofuran-1-yl)phenyl]-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-[4-(4-dibenzofuran-3-yldibenzofuran-1-yl)phenyl]-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155077748 |
| Molecular Formula | C57H33N3O3 |
| Molecular Weight | 807.91 g/mol |
| Exact Mass | 807.25 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-[4-(4-dibenzofuran-3-yldibenzofuran-1-yl)phenyl]-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc(-c5ccc(-c6ccc7c(c6)oc6ccccc67)c6oc7ccccc7c56)cc4)nc(-c4ccc5c(c4)oc4ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C57H33N3O3/c1-2-11-34(12-3-1)37-13-10-14-39(31-37)56-58-55(59-57(60-56)40-26-28-46-44-16-5-8-19-49(44)62-52(46)33-40)36-23-21-35(22-24-36)41-29-30-42(54-53(41)47-17-6-9-20-50(47)63-54)38-25-27-45-43-15-4-7-18-48(43)61-51(45)32-38/h1-33H |
| InChIKey | HFPBGQQIDUEKMT-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.91 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |