About N-dibenzofuran-4-ylacetamide;furan-3-amine
N-dibenzofuran-4-ylacetamide;furan-3-amine (PubChem CID 130442781) has the molecular formula C18H16N2O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is N-dibenzofuran-4-ylacetamide;furan-3-amine.
Molecular Properties
| Compound Name | N-dibenzofuran-4-ylacetamide;furan-3-amine |
| PubChem CID | 130442781 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-dibenzofuran-4-ylacetamide;furan-3-amine |
| SMILES | CC(=O)Nc1cccc2c1oc1ccccc12.Nc1ccoc1 |
| InChI | InChI=1S/C14H11NO2.C4H5NO/c1-9(16)15-12-7-4-6-11-10-5-2-3-8-13(10)17-14(11)12;5-4-1-2-6-3-4/h2-8H,1H3,(H,15,16);1-3H,5H2 |
| InChIKey | KQPJXKJLSHGYSW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-dibenzofuran-4-ylacetamide;furan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dibenzofuran-4-ylacetamide;furan-3-amine?
The IUPAC name of N-dibenzofuran-4-ylacetamide;furan-3-amine (CID 130442781) is N-dibenzofuran-4-ylacetamide;furan-3-amine.
What is the SMILES notation for N-dibenzofuran-4-ylacetamide;furan-3-amine?
The canonical SMILES for N-dibenzofuran-4-ylacetamide;furan-3-amine is CC(=O)Nc1cccc2c1oc1ccccc12.Nc1ccoc1.
What is the InChIKey of N-dibenzofuran-4-ylacetamide;furan-3-amine?
The InChIKey is KQPJXKJLSHGYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2.C4H5NO/c1-9(16)15-12-7-4-6-11-10-5-2-3-8-13(10)17-14(11)12;5-4-1-2-6-3-4/h2-8H,1H3,(H,15,16);1-3H,5H2.
What are the key properties of N-dibenzofuran-4-ylacetamide;furan-3-amine?
N-dibenzofuran-4-ylacetamide;furan-3-amine has a molecular weight of 308.34 g/mol, XLogP of 4.41, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-dibenzofuran-4-ylacetamide;furan-3-amine is sourced from PubChem (CID 130442781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).