C32H44N2O — CID 145094319
ethane;(5Z)-N-[[4-[(Z)-4-iminobut-2-enyl]dibenzofuran-3-yl]methyl]-3-methylhepta-1,5-dien-2-amine;pent-1-ene (PubChem CID 145094319) has the molecular formula C32H44N2O and a molecular weight of 472.72 g/mol. Its IUPAC name is ethane;(5Z)-N-[[4-[(Z)-4-iminobut-2-enyl]dibenzofuran-3-yl]methyl]-3-methylhepta-1,5-dien-2-amine;pent-1-ene.
| Compound Name | ethane;(5Z)-N-[[4-[(Z)-4-iminobut-2-enyl]dibenzofuran-3-yl]methyl]-3-methylhepta-1,5-dien-2-amine;pent-1-ene |
|---|---|
| PubChem CID | 145094319 |
| Molecular Formula | C32H44N2O |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.35 |
| IUPAC Name | ethane;(5Z)-N-[[4-[(Z)-4-iminobut-2-enyl]dibenzofuran-3-yl]methyl]-3-methylhepta-1,5-dien-2-amine;pent-1-ene |
| SMILES | C=CCCC.CC.[H]/N=C/C=C\Cc1c(CNC(=C)C(C)C/C=C\C)ccc2c1oc1ccccc12 |
| InChI | InChI=1S/C25H28N2O.C5H10.C2H6/c1-4-5-10-18(2)19(3)27-17-20-14-15-23-22-12-6-7-13-24(22)28-25(23)21(20)11-8-9-16-26;1-3-5-4-2;1-2/h4-9,12-16,18,26-27H,3,10-11,17H2,1-2H3;3H,1,4-5H2,2H3;1-2H3/b5-4-,9-8-,26-16+;; |
| InChIKey | KSDQZBQHKCNYSE-HISIVBCTSA-N |
| XLogP | 9.54 |
| TPSA | 49.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|