C20H21NO — CID 145067901
(Z)-4-(3-methyl-6-propan-2-yldibenzofuran-4-yl)but-2-en-1-imine (PubChem CID 145067901) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (Z)-4-(3-methyl-6-propan-2-yldibenzofuran-4-yl)but-2-en-1-imine.
| Compound Name | (Z)-4-(3-methyl-6-propan-2-yldibenzofuran-4-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 145067901 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (Z)-4-(3-methyl-6-propan-2-yldibenzofuran-4-yl)but-2-en-1-imine |
| SMILES | [H]/N=C/C=C\Cc1c(C)ccc2c1oc1c(C(C)C)cccc12 |
| InChI | InChI=1S/C20H21NO/c1-13(2)15-8-6-9-17-18-11-10-14(3)16(7-4-5-12-21)20(18)22-19(15)17/h4-6,8-13,21H,7H2,1-3H3/b5-4-,21-12+ |
| InChIKey | BZFLUWCQCCGYTR-YGQYDFCXSA-N |
| XLogP | 5.77 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|