C24H29NO — CID 144815720
(1Z,3Z)-5-(3-methyl-6-propan-2-yldibenzofuran-4-yl)-3-propan-2-ylpenta-1,3-dien-1-amine (PubChem CID 144815720) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is (1Z,3Z)-5-(3-methyl-6-propan-2-yldibenzofuran-4-yl)-3-propan-2-ylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-(3-methyl-6-propan-2-yldibenzofuran-4-yl)-3-propan-2-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144815720 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (1Z,3Z)-5-(3-methyl-6-propan-2-yldibenzofuran-4-yl)-3-propan-2-ylpenta-1,3-dien-1-amine |
| SMILES | Cc1ccc2c(oc3c(C(C)C)cccc32)c1C/C=C(\C=C/N)C(C)C |
| InChI | InChI=1S/C24H29NO/c1-15(2)18(13-14-25)10-12-20-17(5)9-11-22-21-8-6-7-19(16(3)4)23(21)26-24(20)22/h6-11,13-16H,12,25H2,1-5H3/b14-13-,18-10+ |
| InChIKey | QDYDPMQCGLCVDO-LXMWDYQOSA-N |
| XLogP | 6.62 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|